C15H10FN4O3- — CID 54715713
[6-[(Z)-C-(4-fluorophenyl)-N-oxidocarbonimidoyl]-1H-benzimidazol-2-yl]carbamic acid (PubChem CID 54715713) has the molecular formula C15H10FN4O3- and a molecular weight of 313.27 g/mol. Its IUPAC name is [6-[(Z)-C-(4-fluorophenyl)-N-oxidocarbonimidoyl]-1H-benzimidazol-2-yl]carbamic acid.
| Compound Name | [6-[(Z)-C-(4-fluorophenyl)-N-oxidocarbonimidoyl]-1H-benzimidazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 54715713 |
| Molecular Formula | C15H10FN4O3- |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | [6-[(Z)-C-(4-fluorophenyl)-N-oxidocarbonimidoyl]-1H-benzimidazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc2ccc(/C(=N\[O-])c3ccc(F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C15H11FN4O3/c16-10-4-1-8(2-5-10)13(20-23)9-3-6-11-12(7-9)18-14(17-11)19-15(21)22/h1-7,23H,(H,21,22)(H2,17,18,19)/p-1/b20-13- |
| InChIKey | JVYJKPXBVMKPMB-MOSHPQCFSA-M |
| XLogP | 3.13 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|