C22H13ClF2N4O4 — CID 67376754
[6-[2-[(5-chloro-2,4-difluorophenyl)carbamoyl]benzoyl]-1H-benzimidazol-2-yl]carbamic acid (PubChem CID 67376754) has the molecular formula C22H13ClF2N4O4 and a molecular weight of 470.82 g/mol. Its IUPAC name is [6-[2-[(5-chloro-2,4-difluorophenyl)carbamoyl]benzoyl]-1H-benzimidazol-2-yl]carbamic acid.
| Compound Name | [6-[2-[(5-chloro-2,4-difluorophenyl)carbamoyl]benzoyl]-1H-benzimidazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67376754 |
| Molecular Formula | C22H13ClF2N4O4 |
| Molecular Weight | 470.82 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | [6-[2-[(5-chloro-2,4-difluorophenyl)carbamoyl]benzoyl]-1H-benzimidazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1nc2ccc(C(=O)c3ccccc3C(=O)Nc3cc(Cl)c(F)cc3F)cc2[nH]1 |
| InChI | InChI=1S/C22H13ClF2N4O4/c23-13-8-17(15(25)9-14(13)24)26-20(31)12-4-2-1-3-11(12)19(30)10-5-6-16-18(7-10)28-21(27-16)29-22(32)33/h1-9H,(H,26,31)(H,32,33)(H2,27,28,29) |
| InChIKey | BWPJPFBTIVMBQA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|