C11H10O5S — CID 54715743
methyl 4-hydroxy-1,1-dioxo-2H-thiochromene-3-carboxylate (PubChem CID 54715743) has the molecular formula C11H10O5S and a molecular weight of 254.26 g/mol. Its IUPAC name is methyl 4-hydroxy-1,1-dioxo-2H-thiochromene-3-carboxylate.
| Compound Name | methyl 4-hydroxy-1,1-dioxo-2H-thiochromene-3-carboxylate |
|---|---|
| PubChem CID | 54715743 |
| Molecular Formula | C11H10O5S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | methyl 4-hydroxy-1,1-dioxo-2H-thiochromene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)c2ccccc2S(=O)(=O)C1 |
| InChI | InChI=1S/C11H10O5S/c1-16-11(13)8-6-17(14,15)9-5-3-2-4-7(9)10(8)12/h2-5,12H,6H2,1H3 |
| InChIKey | JZUVOLFDJCQFGA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |