About (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium
(3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium (PubChem CID 54715869) has the molecular formula C17H30O6V
and a molecular weight of 381.37 g/mol. Its IUPAC name is (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium.
Molecular Properties
| Compound Name | (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium |
| PubChem CID | 54715869 |
| Molecular Formula | C17H30O6V |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium |
| SMILES | CCCC/C(C(=O)O)=C(\C)O.CCCC/C(C(C)=O)=C(\C)O.O=[V] |
| InChI | InChI=1S/C9H16O2.C8H14O3.O.V/c1-4-5-6-9(7(2)10)8(3)11;1-3-4-5-7(6(2)9)8(10)11;;/h10H,4-6H2,1-3H3;9H,3-5H2,1-2H3,(H,10,11);;/b9-7-;7-6-;; |
| InChIKey | KLRMHXRBVHCIJP-RWAXYPKDSA-N |
| XLogP | 4.57 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium?
The IUPAC name of (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium (CID 54715869) is (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium.
What is the SMILES notation for (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium?
The canonical SMILES for (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium is CCCC/C(C(=O)O)=C(\C)O.CCCC/C(C(C)=O)=C(\C)O.O=[V].
What is the InChIKey of (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium?
The InChIKey is KLRMHXRBVHCIJP-RWAXYPKDSA-N. The full InChI is InChI=1S/C9H16O2.C8H14O3.O.V/c1-4-5-6-9(7(2)10)8(3)11;1-3-4-5-7(6(2)9)8(10)11;;/h10H,4-6H2,1-3H3;9H,3-5H2,1-2H3,(H,10,11);;/b9-7-;7-6-;;.
What are the key properties of (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium?
(3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium has a molecular weight of 381.37 g/mol, XLogP of 4.57, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(1-hydroxyethylidene)heptan-2-one;(2Z)-2-(1-hydroxyethylidene)hexanoic acid;oxovanadium is sourced from PubChem (CID 54715869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).