C29H22O8 — CID 54715909
tribenzyl 4-hydroxy-5-oxocyclopenta-1,3-diene-1,2,3-tricarboxylate (PubChem CID 54715909) has the molecular formula C29H22O8 and a molecular weight of 498.49 g/mol. Its IUPAC name is tribenzyl 4-hydroxy-5-oxocyclopenta-1,3-diene-1,2,3-tricarboxylate.
| Compound Name | tribenzyl 4-hydroxy-5-oxocyclopenta-1,3-diene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 54715909 |
| Molecular Formula | C29H22O8 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | tribenzyl 4-hydroxy-5-oxocyclopenta-1,3-diene-1,2,3-tricarboxylate |
| SMILES | O=C(OCc1ccccc1)C1=C(O)C(=O)C(C(=O)OCc2ccccc2)=C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H22O8/c30-25-23(28(33)36-17-20-12-6-2-7-13-20)22(27(32)35-16-19-10-4-1-5-11-19)24(26(25)31)29(34)37-18-21-14-8-3-9-15-21/h1-15H,16-18H2,(H,30,31) |
| InChIKey | XNLBACTZPPVZRB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|