C5H10N2O4 — CID 54718944
[(2R,4E)-4-carboxy-2-hydroxy-4-oxidoiminobutyl]azanium (PubChem CID 54718944) has the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. Its IUPAC name is [(2R,4E)-4-carboxy-2-hydroxy-4-oxidoiminobutyl]azanium.
| Compound Name | [(2R,4E)-4-carboxy-2-hydroxy-4-oxidoiminobutyl]azanium |
|---|---|
| PubChem CID | 54718944 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | [(2R,4E)-4-carboxy-2-hydroxy-4-oxidoiminobutyl]azanium |
| SMILES | [NH3+]C[C@H](O)C/C(=N\[O-])C(=O)O |
| InChI | InChI=1S/C5H10N2O4/c6-2-3(8)1-4(7-11)5(9)10/h3,8,11H,1-2,6H2,(H,9,10)/b7-4+/t3-/m1/s1 |
| InChIKey | LRXIHGULRCOXMN-AMBGBCQPSA-N |
| XLogP | -2.00 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|