C28H32N4O7 — CID 54719170
4-(dimethylamino)-7-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54719170) has the molecular formula C28H32N4O7 and a molecular weight of 536.59 g/mol. Its IUPAC name is 4-(dimethylamino)-7-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54719170 |
| Molecular Formula | C28H32N4O7 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 4-(dimethylamino)-7-[5-[(dimethylamino)methyl]-1H-pyrrol-2-yl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)Cc1ccc(-c2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)[nH]1 |
| InChI | InChI=1S/C28H32N4O7/c1-31(2)11-13-5-7-17(30-13)14-6-8-18(33)20-15(14)9-12-10-16-22(32(3)4)24(35)21(27(29)38)26(37)28(16,39)25(36)19(12)23(20)34/h5-8,12,16,22,30,33-34,37,39H,9-11H2,1-4H3,(H2,29,38) |
| InChIKey | IVTARJCTKGKGDP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 180.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|