C27H52O4Si — CID 5471932
(2R)-6-methyl-1-[2-[(Z,5S)-5-tri(propan-2-yl)silyloxyhept-3-enyl]-1,3-dioxolan-2-yl]hept-5-en-2-ol (PubChem CID 5471932) has the molecular formula C27H52O4Si and a molecular weight of 468.80 g/mol. Its IUPAC name is (2R)-6-methyl-1-[2-[(Z,5S)-5-tri(propan-2-yl)silyloxyhept-3-enyl]-1,3-dioxolan-2-yl]hept-5-en-2-ol.
| Compound Name | (2R)-6-methyl-1-[2-[(Z,5S)-5-tri(propan-2-yl)silyloxyhept-3-enyl]-1,3-dioxolan-2-yl]hept-5-en-2-ol |
|---|---|
| PubChem CID | 5471932 |
| Molecular Formula | C27H52O4Si |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | (2R)-6-methyl-1-[2-[(Z,5S)-5-tri(propan-2-yl)silyloxyhept-3-enyl]-1,3-dioxolan-2-yl]hept-5-en-2-ol |
| SMILES | CC[C@@H](/C=C\CCC1(C[C@H](O)CCC=C(C)C)OCCO1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H52O4Si/c1-10-26(31-32(22(4)5,23(6)7)24(8)9)16-11-12-17-27(29-18-19-30-27)20-25(28)15-13-14-21(2)3/h11,14,16,22-26,28H,10,12-13,15,17-20H2,1-9H3/b16-11-/t25-,26+/m1/s1 |
| InChIKey | ULPUARIMGQKHOC-DNIGYFMASA-N |
| XLogP | 7.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|