C19H38O4Si — CID 59100012
(Z,1S)-1-[(4S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-en-1-ol (PubChem CID 59100012) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is (Z,1S)-1-[(4S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-en-1-ol.
| Compound Name | (Z,1S)-1-[(4S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-en-1-ol |
|---|---|
| PubChem CID | 59100012 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (Z,1S)-1-[(4S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-2-en-1-ol |
| SMILES | CCCC/C=C\[C@H](O)[C@@H]1OC(C)(C)OC1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O4Si/c1-9-10-11-12-13-15(20)17-16(22-19(5,6)23-17)14-21-24(7,8)18(2,3)4/h12-13,15-17,20H,9-11,14H2,1-8H3/b13-12-/t15-,16?,17-/m0/s1 |
| InChIKey | GIZHVVZVZIIJBS-HQQJDOMUSA-N |
| XLogP | 4.64 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|