C26H18ClN3O3S — CID 54719467
N-[4-(6-chloro-1,3-benzothiazol-2-yl)phenyl]-4-hydroxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide (PubChem CID 54719467) has the molecular formula C26H18ClN3O3S and a molecular weight of 487.97 g/mol. Its IUPAC name is N-[4-(6-chloro-1,3-benzothiazol-2-yl)phenyl]-4-hydroxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide.
| Compound Name | N-[4-(6-chloro-1,3-benzothiazol-2-yl)phenyl]-4-hydroxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54719467 |
| Molecular Formula | C26H18ClN3O3S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | N-[4-(6-chloro-1,3-benzothiazol-2-yl)phenyl]-4-hydroxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide |
| SMILES | C=CCn1c(=O)c(C(=O)Nc2ccc(-c3nc4ccc(Cl)cc4s3)cc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C26H18ClN3O3S/c1-2-13-30-20-6-4-3-5-18(20)23(31)22(26(30)33)24(32)28-17-10-7-15(8-11-17)25-29-19-12-9-16(27)14-21(19)34-25/h2-12,14,31H,1,13H2,(H,28,32) |
| InChIKey | YRHKDCTZYJVGAH-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|