C30H31NO4S — CID 54721672
5-benzylsulfanyl-4-hydroxy-2-[2-(3-morpholin-4-ylphenyl)ethyl]-2-phenyl-3H-pyran-6-one (PubChem CID 54721672) has the molecular formula C30H31NO4S and a molecular weight of 501.65 g/mol. Its IUPAC name is 5-benzylsulfanyl-4-hydroxy-2-[2-(3-morpholin-4-ylphenyl)ethyl]-2-phenyl-3H-pyran-6-one.
| Compound Name | 5-benzylsulfanyl-4-hydroxy-2-[2-(3-morpholin-4-ylphenyl)ethyl]-2-phenyl-3H-pyran-6-one |
|---|---|
| PubChem CID | 54721672 |
| Molecular Formula | C30H31NO4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 5-benzylsulfanyl-4-hydroxy-2-[2-(3-morpholin-4-ylphenyl)ethyl]-2-phenyl-3H-pyran-6-one |
| SMILES | O=C1OC(CCc2cccc(N3CCOCC3)c2)(c2ccccc2)CC(O)=C1SCc1ccccc1 |
| InChI | InChI=1S/C30H31NO4S/c32-27-21-30(25-11-5-2-6-12-25,35-29(33)28(27)36-22-24-8-3-1-4-9-24)15-14-23-10-7-13-26(20-23)31-16-18-34-19-17-31/h1-13,20,32H,14-19,21-22H2 |
| InChIKey | LYQMGACPRDKUGB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |