About cerium(3+);oxido hydrogen carbonate
cerium(3+);oxido hydrogen carbonate (PubChem CID 54723990) has the molecular formula CHCeO4+2
and a molecular weight of 217.13 g/mol. Its IUPAC name is cerium(3+);oxido hydrogen carbonate.
Molecular Properties
| Compound Name | cerium(3+);oxido hydrogen carbonate |
| PubChem CID | 54723990 |
| Molecular Formula | CHCeO4+2 |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 216.89 |
| IUPAC Name | cerium(3+);oxido hydrogen carbonate |
| SMILES | O=C(O)O[O-].[Ce+3] |
| InChI | InChI=1S/CH2O4.Ce/c2-1(3)5-4;/h4H,(H,2,3);/q;+3/p-1 |
| InChIKey | FLUSSORUHHYGCM-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze cerium(3+);oxido hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium(3+);oxido hydrogen carbonate?
The IUPAC name of cerium(3+);oxido hydrogen carbonate (CID 54723990) is cerium(3+);oxido hydrogen carbonate.
What is the SMILES notation for cerium(3+);oxido hydrogen carbonate?
The canonical SMILES for cerium(3+);oxido hydrogen carbonate is O=C(O)O[O-].[Ce+3].
What is the InChIKey of cerium(3+);oxido hydrogen carbonate?
The InChIKey is FLUSSORUHHYGCM-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2O4.Ce/c2-1(3)5-4;/h4H,(H,2,3);/q;+3/p-1.
What are the key properties of cerium(3+);oxido hydrogen carbonate?
cerium(3+);oxido hydrogen carbonate has a molecular weight of 217.13 g/mol, XLogP of -1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cerium(3+);oxido hydrogen carbonate is sourced from PubChem (CID 54723990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).