About diazanium;oxido carbonate
diazanium;oxido carbonate (PubChem CID 22665386) has the molecular formula CH8N2O4
and a molecular weight of 112.08 g/mol. Its IUPAC name is diazanium;oxido carbonate.
Molecular Properties
| Compound Name | diazanium;oxido carbonate |
| PubChem CID | 22665386 |
| Molecular Formula | CH8N2O4 |
| Molecular Weight | 112.08 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | diazanium;oxido carbonate |
| SMILES | O=C([O-])O[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/CH2O4.2H3N/c2-1(3)5-4;;/h4H,(H,2,3);2*1H3 |
| InChIKey | KTBRZOLLRLLIOA-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 145.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.08 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze diazanium;oxido carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;oxido carbonate?
The IUPAC name of diazanium;oxido carbonate (CID 22665386) is diazanium;oxido carbonate.
What is the SMILES notation for diazanium;oxido carbonate?
The canonical SMILES for diazanium;oxido carbonate is O=C([O-])O[O-].[NH4+].[NH4+].
What is the InChIKey of diazanium;oxido carbonate?
The InChIKey is KTBRZOLLRLLIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O4.2H3N/c2-1(3)5-4;;/h4H,(H,2,3);2*1H3.
What are the key properties of diazanium;oxido carbonate?
diazanium;oxido carbonate has a molecular weight of 112.08 g/mol, XLogP of -1.63, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;oxido carbonate is sourced from PubChem (CID 22665386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).