C16H12N4O5S — CID 54724584
4-hydroxy-1-methyl-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-2-oxoquinoline-3-carboxamide (PubChem CID 54724584) has the molecular formula C16H12N4O5S and a molecular weight of 372.36 g/mol. Its IUPAC name is 4-hydroxy-1-methyl-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-2-oxoquinoline-3-carboxamide.
| Compound Name | 4-hydroxy-1-methyl-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54724584 |
| Molecular Formula | C16H12N4O5S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 4-hydroxy-1-methyl-N-[(Z)-(5-nitrothiophen-2-yl)methylideneamino]-2-oxoquinoline-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)N/N=C\c2ccc([N+](=O)[O-])s2)c(O)c2ccccc21 |
| InChI | InChI=1S/C16H12N4O5S/c1-19-11-5-3-2-4-10(11)14(21)13(16(19)23)15(22)18-17-8-9-6-7-12(26-9)20(24)25/h2-8,21H,1H3,(H,18,22)/b17-8- |
| InChIKey | JBGKXCAJNHRIGT-IUXPMGMMSA-N |
| XLogP | 1.98 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|