C17H24O5 — CID 54724811
6-[(2R,3R,4E,6S,7S,8E)-3,7-dihydroxy-6,8-dimethyldeca-4,8-dien-2-yl]-4-hydroxypyran-2-one (PubChem CID 54724811) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 6-[(2R,3R,4E,6S,7S,8E)-3,7-dihydroxy-6,8-dimethyldeca-4,8-dien-2-yl]-4-hydroxypyran-2-one.
| Compound Name | 6-[(2R,3R,4E,6S,7S,8E)-3,7-dihydroxy-6,8-dimethyldeca-4,8-dien-2-yl]-4-hydroxypyran-2-one |
|---|---|
| PubChem CID | 54724811 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 6-[(2R,3R,4E,6S,7S,8E)-3,7-dihydroxy-6,8-dimethyldeca-4,8-dien-2-yl]-4-hydroxypyran-2-one |
| SMILES | C/C=C(\C)[C@@H](O)[C@@H](C)/C=C/[C@@H](O)[C@@H](C)c1cc(O)cc(=O)o1 |
| InChI | InChI=1S/C17H24O5/c1-5-10(2)17(21)11(3)6-7-14(19)12(4)15-8-13(18)9-16(20)22-15/h5-9,11-12,14,17-19,21H,1-4H3/b7-6+,10-5+/t11-,12+,14+,17+/m0/s1 |
| InChIKey | FDSYJSBLPXPUKP-UUDNNSTHSA-N |
| XLogP | 2.33 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|