(Z)-3-hydroxyhex-2-enoic acid

C6H10O3 — CID 54724955

IUPAC(Z)-3-hydroxyhex-2-enoic acid
SMILESCCC/C(O)=C/C(=O)O
InChIInChI=1S/C6H10O3/c1-2-3-5(7)4-6(8)9/h4,7H,2-3H2,1H3,(H,8,9)/b5-4-
InChIKeyOPBQQJOQOGWRME-PLNGDYQASA-N
MW130.14 g/mol
LogP1.31
Rot. Bonds3

About (Z)-3-hydroxyhex-2-enoic acid

(Z)-3-hydroxyhex-2-enoic acid (PubChem CID 54724955) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is (Z)-3-hydroxyhex-2-enoic acid.

Molecular Properties

Compound Name(Z)-3-hydroxyhex-2-enoic acid
PubChem CID54724955
Molecular FormulaC6H10O3
Molecular Weight130.14 g/mol
Exact Mass130.06
IUPAC Name(Z)-3-hydroxyhex-2-enoic acid
SMILESCCC/C(O)=C/C(=O)O
InChIInChI=1S/C6H10O3/c1-2-3-5(7)4-6(8)9/h4,7H,2-3H2,1H3,(H,8,9)/b5-4-
InChIKeyOPBQQJOQOGWRME-PLNGDYQASA-N
XLogP1.31
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.14
LogP ≤ 51.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-3-hydroxyhex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-3-hydroxyhex-2-enoic acid?
The IUPAC name of (Z)-3-hydroxyhex-2-enoic acid (CID 54724955) is (Z)-3-hydroxyhex-2-enoic acid.
What is the SMILES notation for (Z)-3-hydroxyhex-2-enoic acid?
The canonical SMILES for (Z)-3-hydroxyhex-2-enoic acid is CCC/C(O)=C/C(=O)O.
What is the InChIKey of (Z)-3-hydroxyhex-2-enoic acid?
The InChIKey is OPBQQJOQOGWRME-PLNGDYQASA-N. The full InChI is InChI=1S/C6H10O3/c1-2-3-5(7)4-6(8)9/h4,7H,2-3H2,1H3,(H,8,9)/b5-4-.
What are the key properties of (Z)-3-hydroxyhex-2-enoic acid?
(Z)-3-hydroxyhex-2-enoic acid has a molecular weight of 130.14 g/mol, XLogP of 1.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-hydroxyhex-2-enoic acid is sourced from PubChem (CID 54724955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).