C31H25NO5 — CID 54726670
2-[4-[(7-ethoxy-4-hydroxy-2-oxo-3-phenylquinolin-1-yl)methyl]phenyl]benzoic acid (PubChem CID 54726670) has the molecular formula C31H25NO5 and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-[4-[(7-ethoxy-4-hydroxy-2-oxo-3-phenylquinolin-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(7-ethoxy-4-hydroxy-2-oxo-3-phenylquinolin-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 54726670 |
| Molecular Formula | C31H25NO5 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-[4-[(7-ethoxy-4-hydroxy-2-oxo-3-phenylquinolin-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CCOc1ccc2c(O)c(-c3ccccc3)c(=O)n(Cc3ccc(-c4ccccc4C(=O)O)cc3)c2c1 |
| InChI | InChI=1S/C31H25NO5/c1-2-37-23-16-17-26-27(18-23)32(30(34)28(29(26)33)22-8-4-3-5-9-22)19-20-12-14-21(15-13-20)24-10-6-7-11-25(24)31(35)36/h3-18,33H,2,19H2,1H3,(H,35,36) |
| InChIKey | PNHHGWZILUYRFK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |