C18H32O3 — CID 54726681
2-heptyl-5-hexyl-4-hydroxy-2,3-dihydropyran-6-one (PubChem CID 54726681) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is 2-heptyl-5-hexyl-4-hydroxy-2,3-dihydropyran-6-one.
| Compound Name | 2-heptyl-5-hexyl-4-hydroxy-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 54726681 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 2-heptyl-5-hexyl-4-hydroxy-2,3-dihydropyran-6-one |
| SMILES | CCCCCCCC1CC(O)=C(CCCCCC)C(=O)O1 |
| InChI | InChI=1S/C18H32O3/c1-3-5-7-9-10-12-15-14-17(19)16(18(20)21-15)13-11-8-6-4-2/h15,19H,3-14H2,1-2H3 |
| InChIKey | PZWUINGHLHNXOM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|