C35H45N3O10S2 — CID 54726701
2-[[8-[3-[5-[[3-(benzenesulfonamido)phenyl]-cyclopropylmethyl]-4-hydroxy-6-oxopyran-2-yl]propylamino]-8-oxooctanoyl]-methylamino]ethanesulfonic acid (PubChem CID 54726701) has the molecular formula C35H45N3O10S2 and a molecular weight of 731.89 g/mol. Its IUPAC name is 2-[[8-[3-[5-[[3-(benzenesulfonamido)phenyl]-cyclopropylmethyl]-4-hydroxy-6-oxopyran-2-yl]propylamino]-8-oxooctanoyl]-methylamino]ethanesulfonic acid.
| Compound Name | 2-[[8-[3-[5-[[3-(benzenesulfonamido)phenyl]-cyclopropylmethyl]-4-hydroxy-6-oxopyran-2-yl]propylamino]-8-oxooctanoyl]-methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 54726701 |
| Molecular Formula | C35H45N3O10S2 |
| Molecular Weight | 731.89 g/mol |
| Exact Mass | 731.25 |
| IUPAC Name | 2-[[8-[3-[5-[[3-(benzenesulfonamido)phenyl]-cyclopropylmethyl]-4-hydroxy-6-oxopyran-2-yl]propylamino]-8-oxooctanoyl]-methylamino]ethanesulfonic acid |
| SMILES | CN(CCS(=O)(=O)O)C(=O)CCCCCCC(=O)NCCCc1cc(O)c(C(c2cccc(NS(=O)(=O)c3ccccc3)c2)C2CC2)c(=O)o1 |
| InChI | InChI=1S/C35H45N3O10S2/c1-38(21-22-49(43,44)45)32(41)17-8-3-2-7-16-31(40)36-20-10-13-28-24-30(39)34(35(42)48-28)33(25-18-19-25)26-11-9-12-27(23-26)37-50(46,47)29-14-5-4-6-15-29/h4-6,9,11-12,14-15,23-25,33,37,39H,2-3,7-8,10,13,16-22H2,1H3,(H,36,40)(H,43,44,45) |
| InChIKey | RCXIREKFNVGMOU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 200.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|