C29H34N2O6S — CID 67697554
N-[3-[cyclopropyl-[4-hydroxy-6-[4-(oxan-4-yl)butyl]-2-oxopyran-3-yl]methyl]phenyl]pyridine-2-sulfonamide (PubChem CID 67697554) has the molecular formula C29H34N2O6S and a molecular weight of 538.67 g/mol. Its IUPAC name is N-[3-[cyclopropyl-[4-hydroxy-6-[4-(oxan-4-yl)butyl]-2-oxopyran-3-yl]methyl]phenyl]pyridine-2-sulfonamide.
| Compound Name | N-[3-[cyclopropyl-[4-hydroxy-6-[4-(oxan-4-yl)butyl]-2-oxopyran-3-yl]methyl]phenyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 67697554 |
| Molecular Formula | C29H34N2O6S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | N-[3-[cyclopropyl-[4-hydroxy-6-[4-(oxan-4-yl)butyl]-2-oxopyran-3-yl]methyl]phenyl]pyridine-2-sulfonamide |
| SMILES | O=c1oc(CCCCC2CCOCC2)cc(O)c1C(c1cccc(NS(=O)(=O)c2ccccn2)c1)C1CC1 |
| InChI | InChI=1S/C29H34N2O6S/c32-25-19-24(9-2-1-6-20-13-16-36-17-14-20)37-29(33)28(25)27(21-11-12-21)22-7-5-8-23(18-22)31-38(34,35)26-10-3-4-15-30-26/h3-5,7-8,10,15,18-21,27,31-32H,1-2,6,9,11-14,16-17H2 |
| InChIKey | FPFKMNHVHDQYNX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 118.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|