C22H18N2O5S2 — CID 54711542
N-[3-[cyclopropyl-(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-1,3-thiazole-4-sulfonamide (PubChem CID 54711542) has the molecular formula C22H18N2O5S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-1,3-thiazole-4-sulfonamide.
| Compound Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-1,3-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 54711542 |
| Molecular Formula | C22H18N2O5S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxochromen-3-yl)methyl]phenyl]-1,3-thiazole-4-sulfonamide |
| SMILES | O=c1oc2ccccc2c(O)c1C(c1cccc(NS(=O)(=O)c2cscn2)c1)C1CC1 |
| InChI | InChI=1S/C22H18N2O5S2/c25-21-16-6-1-2-7-17(16)29-22(26)20(21)19(13-8-9-13)14-4-3-5-15(10-14)24-31(27,28)18-11-30-12-23-18/h1-7,10-13,19,24-25H,8-9H2 |
| InChIKey | RAUZSEFLHWFIPS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|