C18H19NO6 — CID 54728546
4-hydroxy-6-[(R)-3-methylbutanoyloxy(phenyl)methyl]-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 54728546) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-hydroxy-6-[(R)-3-methylbutanoyloxy(phenyl)methyl]-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 4-hydroxy-6-[(R)-3-methylbutanoyloxy(phenyl)methyl]-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 54728546 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-hydroxy-6-[(R)-3-methylbutanoyloxy(phenyl)methyl]-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | CC(C)CC(=O)O[C@H](c1ccccc1)c1cc(O)c(C(=O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C18H19NO6/c1-10(2)8-14(21)25-16(11-6-4-3-5-7-11)12-9-13(20)15(18(23)24)17(22)19-12/h3-7,9-10,16H,8H2,1-2H3,(H,23,24)(H2,19,20,22)/t16-/m1/s1 |
| InChIKey | RQSUJBPFSUWQSA-MRXNPFEDSA-N |
| XLogP | 2.46 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |