C23H17FN2O3 — CID 54731614
N-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-1-phenylquinoline-3-carboxamide (PubChem CID 54731614) has the molecular formula C23H17FN2O3 and a molecular weight of 388.40 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-1-phenylquinoline-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-1-phenylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54731614 |
| Molecular Formula | C23H17FN2O3 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-hydroxy-2-oxo-1-phenylquinoline-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1c(O)c2ccccc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H17FN2O3/c24-16-12-10-15(11-13-16)14-25-22(28)20-21(27)18-8-4-5-9-19(18)26(23(20)29)17-6-2-1-3-7-17/h1-13,27H,14H2,(H,25,28) |
| InChIKey | KKZPLKBEGROUOA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |