C24H20N2O3 — CID 54731601
N-(2-ethylphenyl)-4-hydroxy-2-oxo-1-phenylquinoline-3-carboxamide (PubChem CID 54731601) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(2-ethylphenyl)-4-hydroxy-2-oxo-1-phenylquinoline-3-carboxamide.
| Compound Name | N-(2-ethylphenyl)-4-hydroxy-2-oxo-1-phenylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54731601 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(2-ethylphenyl)-4-hydroxy-2-oxo-1-phenylquinoline-3-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1c(O)c2ccccc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C24H20N2O3/c1-2-16-10-6-8-14-19(16)25-23(28)21-22(27)18-13-7-9-15-20(18)26(24(21)29)17-11-4-3-5-12-17/h3-15,27H,2H2,1H3,(H,25,28) |
| InChIKey | SUJKHXHZEAYRHS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |