C24H32N2O3 — CID 54733927
2-cyclohexyl-N-(4-cyclohexylphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxamide (PubChem CID 54733927) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 2-cyclohexyl-N-(4-cyclohexylphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxamide.
| Compound Name | 2-cyclohexyl-N-(4-cyclohexylphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxamide |
|---|---|
| PubChem CID | 54733927 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 2-cyclohexyl-N-(4-cyclohexylphenyl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCCCC2)cc1)C1=C(O)CC(C2CCCCC2)NC1=O |
| InChI | InChI=1S/C24H32N2O3/c27-21-15-20(18-9-5-2-6-10-18)26-24(29)22(21)23(28)25-19-13-11-17(12-14-19)16-7-3-1-4-8-16/h11-14,16,18,20,27H,1-10,15H2,(H,25,28)(H,26,29) |
| InChIKey | ZPQVRNQKXCPMIS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|