C12H20O12 — CID 54741820
[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl] (E,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoate (PubChem CID 54741820) has the molecular formula C12H20O12 and a molecular weight of 356.28 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl] (E,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoate.
| Compound Name | [(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl] (E,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoate |
|---|---|
| PubChem CID | 54741820 |
| Molecular Formula | C12H20O12 |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl] (E,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoate |
| SMILES | O=C(O[C@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O)/C(O)=C(\O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C12H20O12/c13-1-4(16)6(17)8(19)9(20)11(22)24-12(3-15)10(21)7(18)5(2-14)23-12/h4-7,10,13-21H,1-3H2/b9-8+/t4-,5+,6+,7+,10-,12-/m0/s1 |
| InChIKey | GSVOEOBFCRPWOR-SZSYWZDQSA-N |
| XLogP | -4.63 |
| TPSA | 217.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | -4.63 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|