C30H38N2O10 — CID 54744061
[1-[(5R,5aR,6S,6aR,7S,10aR)-9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-4-methylpentyl] acetate (PubChem CID 54744061) has the molecular formula C30H38N2O10 and a molecular weight of 586.64 g/mol. Its IUPAC name is [1-[(5R,5aR,6S,6aR,7S,10aR)-9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-4-methylpentyl] acetate.
| Compound Name | [1-[(5R,5aR,6S,6aR,7S,10aR)-9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-4-methylpentyl] acetate |
|---|---|
| PubChem CID | 54744061 |
| Molecular Formula | C30H38N2O10 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | [1-[(5R,5aR,6S,6aR,7S,10aR)-9-carbamoyl-7-(dimethylamino)-1,6,10,10a,12-pentahydroxy-5-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-2-yl]-4-methylpentyl] acetate |
| SMILES | CC(=O)OC(CCC(C)C)c1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3[C@@H](O)[C@@H]1[C@H]2C |
| InChI | InChI=1S/C30H38N2O10/c1-11(2)7-10-16(42-13(4)33)15-9-8-14-12(3)17-19(24(35)18(14)23(15)34)27(38)30(41)21(25(17)36)22(32(5)6)26(37)20(28(30)39)29(31)40/h8-9,11-12,16-17,21-22,25,34-36,39,41H,7,10H2,1-6H3,(H2,31,40)/t12-,16?,17+,21+,22-,25-,30-/m0/s1 |
| InChIKey | FRDGSBYZOQQQTI-KLWMFQBJSA-N |
| XLogP | 1.54 |
| TPSA | 207.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|