About 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one
3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one (PubChem CID 54747099) has the molecular formula C24H15FN2O2S
and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one |
| PubChem CID | 54747099 |
| Molecular Formula | C24H15FN2O2S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one |
| SMILES | O=c1[nH]c2scc(-c3ccc(-c4cccc(F)c4)cc3)c2c(O)c1-c1cccnc1 |
| InChI | InChI=1S/C24H15FN2O2S/c25-18-5-1-3-16(11-18)14-6-8-15(9-7-14)19-13-30-24-21(19)22(28)20(23(29)27-24)17-4-2-10-26-12-17/h1-13H,(H2,27,28,29) |
| InChIKey | DPMPJJRQUVLLNX-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one?
The IUPAC name of 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one (CID 54747099) is 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one.
What is the SMILES notation for 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one?
The canonical SMILES for 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one is O=c1[nH]c2scc(-c3ccc(-c4cccc(F)c4)cc3)c2c(O)c1-c1cccnc1.
What is the InChIKey of 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one?
The InChIKey is DPMPJJRQUVLLNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15FN2O2S/c25-18-5-1-3-16(11-18)14-6-8-15(9-7-14)19-13-30-24-21(19)22(28)20(23(29)27-24)17-4-2-10-26-12-17/h1-13H,(H2,27,28,29).
What are the key properties of 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one?
3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one has a molecular weight of 414.46 g/mol, XLogP of 5.83, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-fluorophenyl)phenyl]-4-hydroxy-5-pyridin-3-yl-7H-thieno[2,3-b]pyridin-6-one is sourced from PubChem (CID 54747099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).