C22H27NO7 — CID 54748047
(3Z)-3-[(2E,4E,6R)-1-hydroxy-4-methyl-6-[(2S,4R,7R,8R)-1,2,7-trimethyl-5-oxo-3,9,10-trioxatricyclo[4.3.1.02,4]decan-8-yl]hepta-2,4-dienylidene]pyrrolidine-2,4-dione (PubChem CID 54748047) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is (3Z)-3-[(2E,4E,6R)-1-hydroxy-4-methyl-6-[(2S,4R,7R,8R)-1,2,7-trimethyl-5-oxo-3,9,10-trioxatricyclo[4.3.1.02,4]decan-8-yl]hepta-2,4-dienylidene]pyrrolidine-2,4-dione.
| Compound Name | (3Z)-3-[(2E,4E,6R)-1-hydroxy-4-methyl-6-[(2S,4R,7R,8R)-1,2,7-trimethyl-5-oxo-3,9,10-trioxatricyclo[4.3.1.02,4]decan-8-yl]hepta-2,4-dienylidene]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 54748047 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (3Z)-3-[(2E,4E,6R)-1-hydroxy-4-methyl-6-[(2S,4R,7R,8R)-1,2,7-trimethyl-5-oxo-3,9,10-trioxatricyclo[4.3.1.02,4]decan-8-yl]hepta-2,4-dienylidene]pyrrolidine-2,4-dione |
| SMILES | CC(/C=C/C(O)=C1\C(=O)CNC1=O)=C\[C@@H](C)[C@H]1OC2(C)OC(C(=O)[C@@H]3O[C@@]32C)[C@@H]1C |
| InChI | InChI=1S/C22H27NO7/c1-10(6-7-13(24)15-14(25)9-23-20(15)27)8-11(2)17-12(3)18-16(26)19-21(4,30-19)22(5,28-17)29-18/h6-8,11-12,17-19,24H,9H2,1-5H3,(H,23,27)/b7-6+,10-8+,15-13-/t11-,12-,17-,18?,19+,21+,22?/m1/s1 |
| InChIKey | URGUBECARCAPRI-NJGLDVICSA-N |
| XLogP | 1.51 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|