C22H27NO6 — CID 138979360
(3E)-3-[(2E,4E,6R)-1-hydroxy-4-methyl-6-(1,4,8-trimethyl-6-oxo-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl)hepta-2,4-dienylidene]pyrrolidine-2,4-dione (PubChem CID 138979360) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is (3E)-3-[(2E,4E,6R)-1-hydroxy-4-methyl-6-(1,4,8-trimethyl-6-oxo-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl)hepta-2,4-dienylidene]pyrrolidine-2,4-dione.
| Compound Name | (3E)-3-[(2E,4E,6R)-1-hydroxy-4-methyl-6-(1,4,8-trimethyl-6-oxo-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl)hepta-2,4-dienylidene]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 138979360 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (3E)-3-[(2E,4E,6R)-1-hydroxy-4-methyl-6-(1,4,8-trimethyl-6-oxo-2,9-dioxabicyclo[3.3.1]non-7-en-3-yl)hepta-2,4-dienylidene]pyrrolidine-2,4-dione |
| SMILES | CC1=CC(=O)C2OC1(C)OC([C@H](C)/C=C(C)/C=C/C(O)=C1/C(=O)CNC1=O)C2C |
| InChI | InChI=1S/C22H27NO6/c1-11(6-7-15(24)18-17(26)10-23-21(18)27)8-12(2)19-14(4)20-16(25)9-13(3)22(5,28-19)29-20/h6-9,12,14,19-20,24H,10H2,1-5H3,(H,23,27)/b7-6+,11-8+,18-15+/t12-,14?,19?,20?,22?/m1/s1 |
| InChIKey | WORJTWSOUPGODS-CDKJYMHYSA-N |
| XLogP | 2.30 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|