C13H18O7 — CID 54749778
triethyl (3Z)-3-hydroxybuta-1,3-diene-1,1,4-tricarboxylate (PubChem CID 54749778) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is triethyl (3Z)-3-hydroxybuta-1,3-diene-1,1,4-tricarboxylate.
| Compound Name | triethyl (3Z)-3-hydroxybuta-1,3-diene-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 54749778 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | triethyl (3Z)-3-hydroxybuta-1,3-diene-1,1,4-tricarboxylate |
| SMILES | CCOC(=O)/C=C(\O)C=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C13H18O7/c1-4-18-11(15)8-9(14)7-10(12(16)19-5-2)13(17)20-6-3/h7-8,14H,4-6H2,1-3H3/b9-8- |
| InChIKey | GPYDFMHMXYCJII-HJWRWDBZSA-N |
| XLogP | 1.04 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|