C14H14FNO4 — CID 54750808
ethyl (2R)-2-(4-fluorophenyl)-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxylate (PubChem CID 54750808) has the molecular formula C14H14FNO4 and a molecular weight of 279.27 g/mol. Its IUPAC name is ethyl (2R)-2-(4-fluorophenyl)-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxylate.
| Compound Name | ethyl (2R)-2-(4-fluorophenyl)-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54750808 |
| Molecular Formula | C14H14FNO4 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | ethyl (2R)-2-(4-fluorophenyl)-4-hydroxy-1-methyl-5-oxo-2H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=O)N(C)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FNO4/c1-3-20-14(19)10-11(16(2)13(18)12(10)17)8-4-6-9(15)7-5-8/h4-7,11,17H,3H2,1-2H3/t11-/m1/s1 |
| InChIKey | VJHXSIGYRDTPMK-LLVKDONJSA-N |
| XLogP | 1.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |