C20H13Br2N3 — CID 54753008
(E)-1-(3-bromophenyl)-N-[2-(3-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methanimine (PubChem CID 54753008) has the molecular formula C20H13Br2N3 and a molecular weight of 455.15 g/mol. Its IUPAC name is (E)-1-(3-bromophenyl)-N-[2-(3-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methanimine.
| Compound Name | (E)-1-(3-bromophenyl)-N-[2-(3-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methanimine |
|---|---|
| PubChem CID | 54753008 |
| Molecular Formula | C20H13Br2N3 |
| Molecular Weight | 455.15 g/mol |
| Exact Mass | 452.95 |
| IUPAC Name | (E)-1-(3-bromophenyl)-N-[2-(3-bromophenyl)imidazo[1,2-a]pyridin-3-yl]methanimine |
| SMILES | Brc1cccc(/C=N/c2c(-c3cccc(Br)c3)nc3ccccn23)c1 |
| InChI | InChI=1S/C20H13Br2N3/c21-16-7-3-5-14(11-16)13-23-20-19(15-6-4-8-17(22)12-15)24-18-9-1-2-10-25(18)20/h1-13H/b23-13+ |
| InChIKey | CEOFTXYMITXYFM-YDZHTSKRSA-N |
| XLogP | 6.28 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.15 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|