About (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate
(2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate (PubChem CID 54753098) has the molecular formula C25H23NO3
and a molecular weight of 385.46 g/mol. Its IUPAC name is (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate.
Molecular Properties
| Compound Name | (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate |
| PubChem CID | 54753098 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate |
| SMILES | CC1(COC(=O)c2ccccc2)Cc2ccccc2CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H23NO3/c1-25(18-29-24(28)20-12-6-3-7-13-20)16-21-14-8-9-15-22(21)17-26(25)23(27)19-10-4-2-5-11-19/h2-15H,16-18H2,1H3 |
| InChIKey | IZIKLIWGNWLSKX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate?
The IUPAC name of (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate (CID 54753098) is (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate.
What is the SMILES notation for (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate?
The canonical SMILES for (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate is CC1(COC(=O)c2ccccc2)Cc2ccccc2CN1C(=O)c1ccccc1.
What is the InChIKey of (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate?
The InChIKey is IZIKLIWGNWLSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO3/c1-25(18-29-24(28)20-12-6-3-7-13-20)16-21-14-8-9-15-22(21)17-26(25)23(27)19-10-4-2-5-11-19/h2-15H,16-18H2,1H3.
What are the key properties of (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate?
(2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate has a molecular weight of 385.46 g/mol, XLogP of 4.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzoyl-3-methyl-1,4-dihydroisoquinolin-3-yl)methyl benzoate is sourced from PubChem (CID 54753098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).