C26H28N4O4 — CID 54753600
diethyl 3,10-dicyano-1,12-dimethyl-2,4,9,11-tetrahydroquinolino[7,8-h]quinoline-3,10-dicarboxylate (PubChem CID 54753600) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is diethyl 3,10-dicyano-1,12-dimethyl-2,4,9,11-tetrahydroquinolino[7,8-h]quinoline-3,10-dicarboxylate.
| Compound Name | diethyl 3,10-dicyano-1,12-dimethyl-2,4,9,11-tetrahydroquinolino[7,8-h]quinoline-3,10-dicarboxylate |
|---|---|
| PubChem CID | 54753600 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | diethyl 3,10-dicyano-1,12-dimethyl-2,4,9,11-tetrahydroquinolino[7,8-h]quinoline-3,10-dicarboxylate |
| SMILES | CCOC(=O)C1(C#N)Cc2ccc3ccc4c(c3c2N(C)C1)N(C)CC(C#N)(C(=O)OCC)C4 |
| InChI | InChI=1S/C26H28N4O4/c1-5-33-23(31)25(13-27)11-18-9-7-17-8-10-19-12-26(14-28,24(32)34-6-2)16-30(4)22(19)20(17)21(18)29(3)15-25/h7-10H,5-6,11-12,15-16H2,1-4H3 |
| InChIKey | SVUINFFISOMCSE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 106.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |