C25H25F2N7O2S — CID 54755551
8-ethyl-6-(3-fluoro-6-methylsulfinyl-2-pyridinyl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54755551) has the molecular formula C25H25F2N7O2S and a molecular weight of 525.59 g/mol. Its IUPAC name is 8-ethyl-6-(3-fluoro-6-methylsulfinyl-2-pyridinyl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-6-(3-fluoro-6-methylsulfinyl-2-pyridinyl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54755551 |
| Molecular Formula | C25H25F2N7O2S |
| Molecular Weight | 525.59 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 8-ethyl-6-(3-fluoro-6-methylsulfinyl-2-pyridinyl)-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2nc(S(C)=O)ccc2F)cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc21 |
| InChI | InChI=1S/C25H25F2N7O2S/c1-3-34-23-15(12-17(24(34)35)22-18(26)5-7-21(31-22)37(2)36)14-29-25(32-23)30-16-4-6-20(19(27)13-16)33-10-8-28-9-11-33/h4-7,12-14,28H,3,8-11H2,1-2H3,(H,29,30,32) |
| InChIKey | SUSBWUWRRXGRTI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|