C31H36N4O8 — CID 54755977
4-[[4-[(3-butan-2-yloxy-4-nitrobenzoyl)amino]-3-propan-2-yloxybenzoyl]amino]-3-propan-2-yloxybenzamide (PubChem CID 54755977) has the molecular formula C31H36N4O8 and a molecular weight of 592.65 g/mol. Its IUPAC name is 4-[[4-[(3-butan-2-yloxy-4-nitrobenzoyl)amino]-3-propan-2-yloxybenzoyl]amino]-3-propan-2-yloxybenzamide.
| Compound Name | 4-[[4-[(3-butan-2-yloxy-4-nitrobenzoyl)amino]-3-propan-2-yloxybenzoyl]amino]-3-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 54755977 |
| Molecular Formula | C31H36N4O8 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 4-[[4-[(3-butan-2-yloxy-4-nitrobenzoyl)amino]-3-propan-2-yloxybenzoyl]amino]-3-propan-2-yloxybenzamide |
| SMILES | CCC(C)Oc1cc(C(=O)Nc2ccc(C(=O)Nc3ccc(C(N)=O)cc3OC(C)C)cc2OC(C)C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H36N4O8/c1-7-19(6)43-28-16-22(10-13-25(28)35(39)40)31(38)34-24-12-9-21(15-27(24)42-18(4)5)30(37)33-23-11-8-20(29(32)36)14-26(23)41-17(2)3/h8-19H,7H2,1-6H3,(H2,32,36)(H,33,37)(H,34,38) |
| InChIKey | PAIQRBDLDDFWQU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 172.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|