C38H62N2O6S — CID 54756401
(4R,5R)-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-5-[4-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethoxy]phenyl]-4,5-dihydro-2H-1λ6-benzothiepin-4-olate (PubChem CID 54756401) has the molecular formula C38H62N2O6S and a molecular weight of 674.99 g/mol. Its IUPAC name is (4R,5R)-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-5-[4-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethoxy]phenyl]-4,5-dihydro-2H-1λ6-benzothiepin-4-olate.
| Compound Name | (4R,5R)-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-5-[4-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethoxy]phenyl]-4,5-dihydro-2H-1λ6-benzothiepin-4-olate |
|---|---|
| PubChem CID | 54756401 |
| Molecular Formula | C38H62N2O6S |
| Molecular Weight | 674.99 g/mol |
| Exact Mass | 674.43 |
| IUPAC Name | (4R,5R)-3,3-dibutyl-7-(dimethylamino)-1,1-dioxo-5-[4-[2-[2-[2-(triethylazaniumyl)ethoxy]ethoxy]ethoxy]phenyl]-4,5-dihydro-2H-1λ6-benzothiepin-4-olate |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(N(C)C)cc2[C@@H](c2ccc(OCCOCCOCC[N+](CC)(CC)CC)cc2)[C@H]1[O-] |
| InChI | InChI=1S/C38H62N2O6S/c1-8-13-21-38(22-14-9-2)30-47(42,43)35-20-17-32(39(6)7)29-34(35)36(37(38)41)31-15-18-33(19-16-31)46-28-27-45-26-25-44-24-23-40(10-3,11-4)12-5/h15-20,29,36-37H,8-14,21-28,30H2,1-7H3/t36-,37-/m1/s1 |
| InChIKey | ZTZSKYOVKKJOHP-FZNHDDJXSA-N |
| XLogP | 6.06 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.99 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|