C31H47IN2O6S — CID 142010704
(4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-[4-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]phenyl]-1,1-dioxo-4,5-dihydro-2H-1λ6,2-benzothiazepin-4-ol (PubChem CID 142010704) has the molecular formula C31H47IN2O6S and a molecular weight of 702.70 g/mol. Its IUPAC name is (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-[4-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]phenyl]-1,1-dioxo-4,5-dihydro-2H-1λ6,2-benzothiazepin-4-ol.
| Compound Name | (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-[4-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]phenyl]-1,1-dioxo-4,5-dihydro-2H-1λ6,2-benzothiazepin-4-ol |
|---|---|
| PubChem CID | 142010704 |
| Molecular Formula | C31H47IN2O6S |
| Molecular Weight | 702.70 g/mol |
| Exact Mass | 702.22 |
| IUPAC Name | (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-[4-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]phenyl]-1,1-dioxo-4,5-dihydro-2H-1λ6,2-benzothiazepin-4-ol |
| SMILES | CCCCC1(CCCC)NS(=O)(=O)c2ccc(N(C)C)cc2[C@@H](c2ccc(OCCOCCOCCI)cc2)[C@H]1O |
| InChI | InChI=1S/C31H47IN2O6S/c1-5-7-15-31(16-8-6-2)30(35)29(27-23-25(34(3)4)11-14-28(27)41(36,37)33-31)24-9-12-26(13-10-24)40-22-21-39-20-19-38-18-17-32/h9-14,23,29-30,33,35H,5-8,15-22H2,1-4H3/t29-,30-/m1/s1 |
| InChIKey | QMXZQRUKERPRHF-LOYHVIPDSA-N |
| XLogP | 5.50 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|