C34H47N3O5S — CID 155033442
(4R)-3,3-bis(butylamino)-7-(dimethylamino)-5-[4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 155033442) has the molecular formula C34H47N3O5S and a molecular weight of 609.83 g/mol. Its IUPAC name is (4R)-3,3-bis(butylamino)-7-(dimethylamino)-5-[4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (4R)-3,3-bis(butylamino)-7-(dimethylamino)-5-[4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 155033442 |
| Molecular Formula | C34H47N3O5S |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | (4R)-3,3-bis(butylamino)-7-(dimethylamino)-5-[4-[[4-(hydroxymethyl)phenyl]methoxy]phenyl]-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCCNC1(NCCCC)CS(=O)(=O)c2ccc(N(C)C)cc2C(c2ccc(OCc3ccc(CO)cc3)cc2)[C@H]1O |
| InChI | InChI=1S/C34H47N3O5S/c1-5-7-19-35-34(36-20-8-6-2)24-43(40,41)31-18-15-28(37(3)4)21-30(31)32(33(34)39)27-13-16-29(17-14-27)42-23-26-11-9-25(22-38)10-12-26/h9-18,21,32-33,35-36,38-39H,5-8,19-20,22-24H2,1-4H3/t32?,33-/m1/s1 |
| InChIKey | SUMLVIVHCSIYEV-ZHZZGXISSA-N |
| XLogP | 4.58 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|