C29H43N3O3S2 — CID 58053085
1-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-3-ethylthiourea (PubChem CID 58053085) has the molecular formula C29H43N3O3S2 and a molecular weight of 545.82 g/mol. Its IUPAC name is 1-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-3-ethylthiourea.
| Compound Name | 1-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 58053085 |
| Molecular Formula | C29H43N3O3S2 |
| Molecular Weight | 545.82 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 1-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-3-ethylthiourea |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(N(C)C)cc2C(c2cccc(NC(=S)NCC)c2)C1O |
| InChI | InChI=1S/C29H43N3O3S2/c1-6-9-16-29(17-10-7-2)20-37(34,35)25-15-14-23(32(4)5)19-24(25)26(27(29)33)21-12-11-13-22(18-21)31-28(36)30-8-3/h11-15,18-19,26-27,33H,6-10,16-17,20H2,1-5H3,(H2,30,31,36) |
| InChIKey | RTZKTUNTAQBMED-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.82 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|