C24H34N2O3S — CID 59953691
(3R,4S,5S)-5-(3-aminophenyl)-3-butyl-7-(dimethylamino)-3-ethyl-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 59953691) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is (3R,4S,5S)-5-(3-aminophenyl)-3-butyl-7-(dimethylamino)-3-ethyl-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (3R,4S,5S)-5-(3-aminophenyl)-3-butyl-7-(dimethylamino)-3-ethyl-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 59953691 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (3R,4S,5S)-5-(3-aminophenyl)-3-butyl-7-(dimethylamino)-3-ethyl-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCC[C@@]1(CC)CS(=O)(=O)c2ccc(N(C)C)cc2[C@H](c2cccc(N)c2)[C@@H]1O |
| InChI | InChI=1S/C24H34N2O3S/c1-5-7-13-24(6-2)16-30(28,29)21-12-11-19(26(3)4)15-20(21)22(23(24)27)17-9-8-10-18(25)14-17/h8-12,14-15,22-23,27H,5-7,13,16,25H2,1-4H3/t22-,23-,24-/m0/s1 |
| InChIKey | KAOKHPGCPUOUPG-HJOGWXRNSA-N |
| XLogP | 4.20 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|