C26H40N2OS — CID 143885350
(3S)-5-(3-aminophenyl)-3-butyl-7-(dimethylamino)-3-ethyl-4,5-dihydro-2H-1-benzothiepin-4-ol;ethane (PubChem CID 143885350) has the molecular formula C26H40N2OS and a molecular weight of 428.69 g/mol. Its IUPAC name is (3S)-5-(3-aminophenyl)-3-butyl-7-(dimethylamino)-3-ethyl-4,5-dihydro-2H-1-benzothiepin-4-ol;ethane.
| Compound Name | (3S)-5-(3-aminophenyl)-3-butyl-7-(dimethylamino)-3-ethyl-4,5-dihydro-2H-1-benzothiepin-4-ol;ethane |
|---|---|
| PubChem CID | 143885350 |
| Molecular Formula | C26H40N2OS |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | (3S)-5-(3-aminophenyl)-3-butyl-7-(dimethylamino)-3-ethyl-4,5-dihydro-2H-1-benzothiepin-4-ol;ethane |
| SMILES | CC.CCCC[C@]1(CC)CSc2ccc(N(C)C)cc2C(c2cccc(N)c2)C1O |
| InChI | InChI=1S/C24H34N2OS.C2H6/c1-5-7-13-24(6-2)16-28-21-12-11-19(26(3)4)15-20(21)22(23(24)27)17-9-8-10-18(25)14-17;1-2/h8-12,14-15,22-23,27H,5-7,13,16,25H2,1-4H3;1-2H3/t22?,23?,24-;/m1./s1 |
| InChIKey | CAZPXARLMYFPRJ-DYVOGRNMSA-N |
| XLogP | 6.55 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|