C29H45IN2O3S — CID 67454625
[3-[(4R,5R)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-trimethylazanium iodide (PubChem CID 67454625) has the molecular formula C29H45IN2O3S and a molecular weight of 628.66 g/mol. Its IUPAC name is [3-[(4R,5R)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-trimethylazanium iodide.
| Compound Name | [3-[(4R,5R)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 67454625 |
| Molecular Formula | C29H45IN2O3S |
| Molecular Weight | 628.66 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | [3-[(4R,5R)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]-trimethylazanium iodide |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(N(C)C)cc2[C@@H](c2cccc([N+](C)(C)C)c2)[C@H]1O.[I-] |
| InChI | InChI=1S/C29H45N2O3S.HI/c1-8-10-17-29(18-11-9-2)21-35(33,34)26-16-15-23(30(3)4)20-25(26)27(28(29)32)22-13-12-14-24(19-22)31(5,6)7;/h12-16,19-20,27-28,32H,8-11,17-18,21H2,1-7H3;1H/q+1;/p-1/t27-,28-;/m1./s1 |
| InChIKey | VMPQBDSSYKWBHL-LTRMXRMOSA-M |
| XLogP | 2.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|