C30H44N2O4S — CID 144840214
N-[3-[(3S)-3-butyl-7-(dimethylamino)-3-ethyl-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]hexanamide (PubChem CID 144840214) has the molecular formula C30H44N2O4S and a molecular weight of 528.76 g/mol. Its IUPAC name is N-[3-[(3S)-3-butyl-7-(dimethylamino)-3-ethyl-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]hexanamide.
| Compound Name | N-[3-[(3S)-3-butyl-7-(dimethylamino)-3-ethyl-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 144840214 |
| Molecular Formula | C30H44N2O4S |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | N-[3-[(3S)-3-butyl-7-(dimethylamino)-3-ethyl-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(C2c3cc(N(C)C)ccc3S(=O)(=O)C[C@@](CC)(CCCC)C2O)c1 |
| InChI | InChI=1S/C30H44N2O4S/c1-6-9-11-15-27(33)31-23-14-12-13-22(19-23)28-25-20-24(32(4)5)16-17-26(25)37(35,36)21-30(8-3,29(28)34)18-10-7-2/h12-14,16-17,19-20,28-29,34H,6-11,15,18,21H2,1-5H3,(H,31,33)/t28?,29?,30-/m1/s1 |
| InChIKey | NJQMDSANFFNHBS-QGVFFIPKSA-N |
| XLogP | 6.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|