C37H59ClN3O4S- — CID 158812847
5-[butan-2-yl(ethyl)amino]-N-[3-[(4R,5R)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]pentanamide chloride (PubChem CID 158812847) has the molecular formula C37H59ClN3O4S- and a molecular weight of 677.42 g/mol. Its IUPAC name is 5-[butan-2-yl(ethyl)amino]-N-[3-[(4R,5R)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]pentanamide chloride.
| Compound Name | 5-[butan-2-yl(ethyl)amino]-N-[3-[(4R,5R)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]pentanamide chloride |
|---|---|
| PubChem CID | 158812847 |
| Molecular Formula | C37H59ClN3O4S- |
| Molecular Weight | 677.42 g/mol |
| Exact Mass | 676.39 |
| IUPAC Name | 5-[butan-2-yl(ethyl)amino]-N-[3-[(4R,5R)-3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]phenyl]pentanamide chloride |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(N(C)C)cc2[C@@H](c2cccc(NC(=O)CCCCN(CC)C(C)CC)c2)[C@H]1O.[Cl-] |
| InChI | InChI=1S/C37H59N3O4S.ClH/c1-8-12-22-37(23-13-9-2)27-45(43,44)33-21-20-31(39(6)7)26-32(33)35(36(37)42)29-17-16-18-30(25-29)38-34(41)19-14-15-24-40(11-4)28(5)10-3;/h16-18,20-21,25-26,28,35-36,42H,8-15,19,22-24,27H2,1-7H3,(H,38,41);1H/p-1/t28?,35-,36-;/m1./s1 |
| InChIKey | CJXFJLZHNWEXSB-IWZYJQIISA-M |
| XLogP | 4.63 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|