C29H44N2O6S2 — CID 21333731
3-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]anilino]propane-1-sulfonic acid (PubChem CID 21333731) has the molecular formula C29H44N2O6S2 and a molecular weight of 580.81 g/mol. Its IUPAC name is 3-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]anilino]propane-1-sulfonic acid.
| Compound Name | 3-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]anilino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 21333731 |
| Molecular Formula | C29H44N2O6S2 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 3-[3-[3,3-dibutyl-7-(dimethylamino)-4-hydroxy-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]anilino]propane-1-sulfonic acid |
| SMILES | CCCCC1(CCCC)CS(=O)(=O)c2ccc(N(C)C)cc2C(c2cccc(NCCCS(=O)(=O)O)c2)C1O |
| InChI | InChI=1S/C29H44N2O6S2/c1-5-7-15-29(16-8-6-2)21-38(33,34)26-14-13-24(31(3)4)20-25(26)27(28(29)32)22-11-9-12-23(19-22)30-17-10-18-39(35,36)37/h9,11-14,19-20,27-28,30,32H,5-8,10,15-18,21H2,1-4H3,(H,35,36,37) |
| InChIKey | WYYWYNVBAMYQDB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|