C12H21IO2 — CID 54756608
(2R,3S,4S,5S,6R)-2-[(2R)-but-3-en-2-yl]-6-(iodomethyl)-3,5-dimethyloxan-4-ol (PubChem CID 54756608) has the molecular formula C12H21IO2 and a molecular weight of 324.20 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[(2R)-but-3-en-2-yl]-6-(iodomethyl)-3,5-dimethyloxan-4-ol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[(2R)-but-3-en-2-yl]-6-(iodomethyl)-3,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 54756608 |
| Molecular Formula | C12H21IO2 |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[(2R)-but-3-en-2-yl]-6-(iodomethyl)-3,5-dimethyloxan-4-ol |
| SMILES | C=C[C@@H](C)[C@H]1O[C@@H](CI)[C@@H](C)[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C12H21IO2/c1-5-7(2)12-9(4)11(14)8(3)10(6-13)15-12/h5,7-12,14H,1,6H2,2-4H3/t7-,8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | BBVWPSDXYYSZHQ-PQTSNVLCSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|