C13H23IO2 — CID 10427226
(2S)-2-[(2R,5S,6R)-6-[(E)-1-iodobut-1-en-2-yl]-5-methyloxan-2-yl]propan-1-ol (PubChem CID 10427226) has the molecular formula C13H23IO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is (2S)-2-[(2R,5S,6R)-6-[(E)-1-iodobut-1-en-2-yl]-5-methyloxan-2-yl]propan-1-ol.
| Compound Name | (2S)-2-[(2R,5S,6R)-6-[(E)-1-iodobut-1-en-2-yl]-5-methyloxan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 10427226 |
| Molecular Formula | C13H23IO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (2S)-2-[(2R,5S,6R)-6-[(E)-1-iodobut-1-en-2-yl]-5-methyloxan-2-yl]propan-1-ol |
| SMILES | CC/C(=C\I)[C@@H]1O[C@@H]([C@@H](C)CO)CC[C@@H]1C |
| InChI | InChI=1S/C13H23IO2/c1-4-11(7-14)13-9(2)5-6-12(16-13)10(3)8-15/h7,9-10,12-13,15H,4-6,8H2,1-3H3/b11-7+/t9-,10-,12+,13+/m0/s1 |
| InChIKey | BFSKIQUOHWTQIC-ZCWHDKNASA-N |
| XLogP | 3.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|