C12H19ClN2 — CID 547568
N-(4-chlorophenyl)-N',N',2-trimethylpropane-1,3-diamine (PubChem CID 547568) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N',N',2-trimethylpropane-1,3-diamine.
| Compound Name | N-(4-chlorophenyl)-N',N',2-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 547568 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | N-(4-chlorophenyl)-N',N',2-trimethylpropane-1,3-diamine |
| SMILES | CC(CNc1ccc(Cl)cc1)CN(C)C |
| InChI | InChI=1S/C12H19ClN2/c1-10(9-15(2)3)8-14-12-6-4-11(13)5-7-12/h4-7,10,14H,8-9H2,1-3H3 |
| InChIKey | WMGUGBLCOSAFPI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |